C12H13Br2N3O2 — CID 103744723
N-[(3,5-dibromo-4-methoxyphenyl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 103744723) has the molecular formula C12H13Br2N3O2 and a molecular weight of 391.06 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-methoxyphenyl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | N-[(3,5-dibromo-4-methoxyphenyl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 103744723 |
| Molecular Formula | C12H13Br2N3O2 |
| Molecular Weight | 391.06 g/mol |
| Exact Mass | 388.94 |
| IUPAC Name | N-[(3,5-dibromo-4-methoxyphenyl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | COc1c(Br)cc(CNCCc2ncno2)cc1Br |
| InChI | InChI=1S/C12H13Br2N3O2/c1-18-12-9(13)4-8(5-10(12)14)6-15-3-2-11-16-7-17-19-11/h4-5,7,15H,2-3,6H2,1H3 |
| InChIKey | FNFLOYFVVDFBSY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.06 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|