C12H11F4N3O — CID 103821573
N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 103821573) has the molecular formula C12H11F4N3O and a molecular weight of 289.23 g/mol. Its IUPAC name is N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 103821573 |
| Molecular Formula | C12H11F4N3O |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | Fc1ccc(CNCCc2ncno2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F4N3O/c13-9-2-1-8(10(5-9)12(14,15)16)6-17-4-3-11-18-7-19-20-11/h1-2,5,7,17H,3-4,6H2 |
| InChIKey | VIMACKAKCMQGBR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|