C13H13N3O4S — CID 103763936
N-[3-(methylsulfamoyl)phenyl]-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 103763936) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is N-[3-(methylsulfamoyl)phenyl]-2-oxo-1H-pyridine-4-carboxamide.
| Compound Name | N-[3-(methylsulfamoyl)phenyl]-2-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103763936 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-[3-(methylsulfamoyl)phenyl]-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | CNS(=O)(=O)c1cccc(NC(=O)c2cc[nH]c(=O)c2)c1 |
| InChI | InChI=1S/C13H13N3O4S/c1-14-21(19,20)11-4-2-3-10(8-11)16-13(18)9-5-6-15-12(17)7-9/h2-8,14H,1H3,(H,15,17)(H,16,18) |
| InChIKey | WRQUEZQMKQBDRH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |