C11H19NO2S — CID 103765738
N-(3-tricyclo[3.2.1.02,4]octanyl)propane-2-sulfonamide (PubChem CID 103765738) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is N-(3-tricyclo[3.2.1.02,4]octanyl)propane-2-sulfonamide.
| Compound Name | N-(3-tricyclo[3.2.1.02,4]octanyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 103765738 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-(3-tricyclo[3.2.1.02,4]octanyl)propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C11H19NO2S/c1-6(2)15(13,14)12-11-9-7-3-4-8(5-7)10(9)11/h6-12H,3-5H2,1-2H3 |
| InChIKey | FCILEHUCXKIRHE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |