C8H13F2NO2S — CID 103770166
N-(3,3-difluoro-2-hydroxypropyl)thiolane-3-carboxamide (PubChem CID 103770166) has the molecular formula C8H13F2NO2S and a molecular weight of 225.26 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)thiolane-3-carboxamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 103770166 |
| Molecular Formula | C8H13F2NO2S |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)thiolane-3-carboxamide |
| SMILES | O=C(NCC(O)C(F)F)C1CCSC1 |
| InChI | InChI=1S/C8H13F2NO2S/c9-7(10)6(12)3-11-8(13)5-1-2-14-4-5/h5-7,12H,1-4H2,(H,11,13) |
| InChIKey | URFLMKOLPWPXBD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |