C9H7N3O2S2 — CID 103772195
methyl 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carboxylate (PubChem CID 103772195) has the molecular formula C9H7N3O2S2 and a molecular weight of 253.31 g/mol. Its IUPAC name is methyl 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carboxylate.
| Compound Name | methyl 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 103772195 |
| Molecular Formula | C9H7N3O2S2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | methyl 5-(1,3-thiazol-2-ylsulfanyl)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(Sc2nccs2)cn1 |
| InChI | InChI=1S/C9H7N3O2S2/c1-14-8(13)6-4-12-7(5-11-6)16-9-10-2-3-15-9/h2-5H,1H3 |
| InChIKey | NILBDORNBUVMNH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|