C16H13F2N3O2 — CID 10381105
1-[(2,4-difluorophenyl)methyl]-N-methoxypyrrolo[2,3-c]pyridine-5-carboxamide (PubChem CID 10381105) has the molecular formula C16H13F2N3O2 and a molecular weight of 317.30 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-N-methoxypyrrolo[2,3-c]pyridine-5-carboxamide.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-N-methoxypyrrolo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 10381105 |
| Molecular Formula | C16H13F2N3O2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-N-methoxypyrrolo[2,3-c]pyridine-5-carboxamide |
| SMILES | CONC(=O)c1cc2ccn(Cc3ccc(F)cc3F)c2cn1 |
| InChI | InChI=1S/C16H13F2N3O2/c1-23-20-16(22)14-6-10-4-5-21(15(10)8-19-14)9-11-2-3-12(17)7-13(11)18/h2-8H,9H2,1H3,(H,20,22) |
| InChIKey | IMSFAUQJHWMGHJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|