C23H25NO — CID 10382047
(3S,7R)-10-benzhydryl-1-azatricyclo[5.3.1.03,8]undecan-9-one (PubChem CID 10382047) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is (3S,7R)-10-benzhydryl-1-azatricyclo[5.3.1.03,8]undecan-9-one.
| Compound Name | (3S,7R)-10-benzhydryl-1-azatricyclo[5.3.1.03,8]undecan-9-one |
|---|---|
| PubChem CID | 10382047 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (3S,7R)-10-benzhydryl-1-azatricyclo[5.3.1.03,8]undecan-9-one |
| SMILES | O=C1C2[C@@H]3CCC[C@H]2CN(C3)C1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25NO/c25-23-21-18-12-7-13-19(21)15-24(14-18)22(23)20(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,18-22H,7,12-15H2/t18-,19+,21?,22? |
| InChIKey | DCJHPAJHJYDJGV-IVCWUUCSSA-N |
| XLogP | 4.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |