C20H20ClNO — CID 129404690
(2S)-2-[(R)-(4-chlorophenyl)-phenylmethyl]-1-azabicyclo[2.2.2]octan-3-one (PubChem CID 129404690) has the molecular formula C20H20ClNO and a molecular weight of 325.84 g/mol. Its IUPAC name is (2S)-2-[(R)-(4-chlorophenyl)-phenylmethyl]-1-azabicyclo[2.2.2]octan-3-one.
| Compound Name | (2S)-2-[(R)-(4-chlorophenyl)-phenylmethyl]-1-azabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 129404690 |
| Molecular Formula | C20H20ClNO |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2S)-2-[(R)-(4-chlorophenyl)-phenylmethyl]-1-azabicyclo[2.2.2]octan-3-one |
| SMILES | O=C1C2CCN(CC2)[C@H]1[C@H](c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClNO/c21-17-8-6-15(7-9-17)18(14-4-2-1-3-5-14)19-20(23)16-10-12-22(19)13-11-16/h1-9,16,18-19H,10-13H2/t18-,19+/m1/s1 |
| InChIKey | GZYRHDWIPQORQX-MOPGFXCFSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |