About 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine
2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine (PubChem CID 162206182) has the molecular formula C19H19I2NO
and a molecular weight of 531.18 g/mol. Its IUPAC name is 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine.
Molecular Properties
| Compound Name | 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine |
| PubChem CID | 162206182 |
| Molecular Formula | C19H19I2NO |
| Molecular Weight | 531.18 g/mol |
| Exact Mass | 530.96 |
| IUPAC Name | 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine |
| SMILES | II.O=C1C2CCN(C2)C1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO.I2/c21-19-16-11-12-20(13-16)18(19)17(14-7-3-1-4-8-14)15-9-5-2-6-10-15;1-2/h1-10,16-18H,11-13H2; |
| InChIKey | ZSFHMKCOTSHOAI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.18 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine?
The IUPAC name of 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine (CID 162206182) is 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine.
What is the SMILES notation for 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine?
The canonical SMILES for 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine is II.O=C1C2CCN(C2)C1C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine?
The InChIKey is ZSFHMKCOTSHOAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO.I2/c21-19-16-11-12-20(13-16)18(19)17(14-7-3-1-4-8-14)15-9-5-2-6-10-15;1-2/h1-10,16-18H,11-13H2;.
What are the key properties of 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine?
2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine has a molecular weight of 531.18 g/mol, XLogP of 4.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydryl-1-azabicyclo[2.2.1]heptan-3-one;molecular iodine is sourced from PubChem (CID 162206182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).