C17H21N3O3S — CID 10383069
N'-hydroxy-N-(4-phenyl-1,3-thiazol-2-yl)octanediamide (PubChem CID 10383069) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N'-hydroxy-N-(4-phenyl-1,3-thiazol-2-yl)octanediamide.
| Compound Name | N'-hydroxy-N-(4-phenyl-1,3-thiazol-2-yl)octanediamide |
|---|---|
| PubChem CID | 10383069 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N'-hydroxy-N-(4-phenyl-1,3-thiazol-2-yl)octanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1nc(-c2ccccc2)cs1)NO |
| InChI | InChI=1S/C17H21N3O3S/c21-15(10-6-1-2-7-11-16(22)20-23)19-17-18-14(12-24-17)13-8-4-3-5-9-13/h3-5,8-9,12,23H,1-2,6-7,10-11H2,(H,20,22)(H,18,19,21) |
| InChIKey | BDTAPZUZFJRPNM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|