C14H20N6OS2 — CID 10383386
N-butyl-5-methylsulfanyl-8-oxo-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carbothioamide (PubChem CID 10383386) has the molecular formula C14H20N6OS2 and a molecular weight of 352.49 g/mol. Its IUPAC name is N-butyl-5-methylsulfanyl-8-oxo-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carbothioamide.
| Compound Name | N-butyl-5-methylsulfanyl-8-oxo-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carbothioamide |
|---|---|
| PubChem CID | 10383386 |
| Molecular Formula | C14H20N6OS2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-butyl-5-methylsulfanyl-8-oxo-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carbothioamide |
| SMILES | CCCCNC(=S)N1CCc2nc3nc(SC)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C14H20N6OS2/c1-3-4-6-15-14(22)19-7-5-10-9(8-19)11(21)20-12(16-10)17-13(18-20)23-2/h3-8H2,1-2H3,(H,15,22)(H,16,17,18) |
| InChIKey | NADVVQOMSFXWBI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|