C10H13BrF3N3O — CID 103837672
5-bromo-4-methoxy-N-(5,5,5-trifluoropentyl)pyrimidin-2-amine (PubChem CID 103837672) has the molecular formula C10H13BrF3N3O and a molecular weight of 328.13 g/mol. Its IUPAC name is 5-bromo-4-methoxy-N-(5,5,5-trifluoropentyl)pyrimidin-2-amine.
| Compound Name | 5-bromo-4-methoxy-N-(5,5,5-trifluoropentyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 103837672 |
| Molecular Formula | C10H13BrF3N3O |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 5-bromo-4-methoxy-N-(5,5,5-trifluoropentyl)pyrimidin-2-amine |
| SMILES | COc1nc(NCCCCC(F)(F)F)ncc1Br |
| InChI | InChI=1S/C10H13BrF3N3O/c1-18-8-7(11)6-16-9(17-8)15-5-3-2-4-10(12,13)14/h6H,2-5H2,1H3,(H,15,16,17) |
| InChIKey | ZPRNWIHKFIDCQQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|