C19H38O4Si — CID 10383794
(2R,3R,6S)-6-[(E,2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-methylpent-3-enyl]-3-methyloxan-2-ol (PubChem CID 10383794) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is (2R,3R,6S)-6-[(E,2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-methylpent-3-enyl]-3-methyloxan-2-ol.
| Compound Name | (2R,3R,6S)-6-[(E,2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-methylpent-3-enyl]-3-methyloxan-2-ol |
|---|---|
| PubChem CID | 10383794 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (2R,3R,6S)-6-[(E,2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-methylpent-3-enyl]-3-methyloxan-2-ol |
| SMILES | CO[C@@H](C[C@@H]1CC[C@@H](C)[C@H](O)O1)/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O4Si/c1-14(11-12-22-24(7,8)19(3,4)5)17(21-6)13-16-10-9-15(2)18(20)23-16/h11,15-18,20H,9-10,12-13H2,1-8H3/b14-11+/t15-,16+,17+,18-/m1/s1 |
| InChIKey | XYJBBAJNZOJMID-PYTMWAQOSA-N |
| XLogP | 4.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|