About N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide
N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide (PubChem CID 103847900) has the molecular formula C7H12N2O3S2
and a molecular weight of 236.32 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 103847900 |
| Molecular Formula | C7H12N2O3S2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)N(C)CCO)s1 |
| InChI | InChI=1S/C7H12N2O3S2/c1-6-8-5-7(13-6)14(11,12)9(2)3-4-10/h5,10H,3-4H2,1-2H3 |
| InChIKey | IIQUUVIXZMANRS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide (CID 103847900) is N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide is Cc1ncc(S(=O)(=O)N(C)CCO)s1.
What is the InChIKey of N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The InChIKey is IIQUUVIXZMANRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3S2/c1-6-8-5-7(13-6)14(11,12)9(2)3-4-10/h5,10H,3-4H2,1-2H3.
What are the key properties of N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide has a molecular weight of 236.32 g/mol, XLogP of 0.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 103847900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).