C16H21NO3 — CID 103849225
(E)-3-(2,4-dimethylphenyl)-N-[(3-hydroxyoxolan-3-yl)methyl]prop-2-enamide (PubChem CID 103849225) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-N-[(3-hydroxyoxolan-3-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-N-[(3-hydroxyoxolan-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 103849225 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-N-[(3-hydroxyoxolan-3-yl)methyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NCC2(O)CCOC2)c(C)c1 |
| InChI | InChI=1S/C16H21NO3/c1-12-3-4-14(13(2)9-12)5-6-15(18)17-10-16(19)7-8-20-11-16/h3-6,9,19H,7-8,10-11H2,1-2H3,(H,17,18)/b6-5+ |
| InChIKey | CRPQTRHLMYHYQV-AATRIKPKSA-N |
| XLogP | 1.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|