C17H23NO2S — CID 111486575
3-(2,4-dimethylphenyl)-N-[(4-hydroxythian-4-yl)methyl]prop-2-enamide (PubChem CID 111486575) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-N-[(4-hydroxythian-4-yl)methyl]prop-2-enamide.
| Compound Name | 3-(2,4-dimethylphenyl)-N-[(4-hydroxythian-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 111486575 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-N-[(4-hydroxythian-4-yl)methyl]prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)NCC2(O)CCSCC2)c(C)c1 |
| InChI | InChI=1S/C17H23NO2S/c1-13-3-4-15(14(2)11-13)5-6-16(19)18-12-17(20)7-9-21-10-8-17/h3-6,11,20H,7-10,12H2,1-2H3,(H,18,19) |
| InChIKey | ILQORKIKHLDFEC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|