C22H26O4S — CID 10385502
(1S,2S,5S,6R,7R)-6-(benzenesulfonyl)-2,7-dimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]octane (PubChem CID 10385502) has the molecular formula C22H26O4S and a molecular weight of 386.51 g/mol. Its IUPAC name is (1S,2S,5S,6R,7R)-6-(benzenesulfonyl)-2,7-dimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]octane.
| Compound Name | (1S,2S,5S,6R,7R)-6-(benzenesulfonyl)-2,7-dimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 10385502 |
| Molecular Formula | C22H26O4S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (1S,2S,5S,6R,7R)-6-(benzenesulfonyl)-2,7-dimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]octane |
| SMILES | C[C@H]1[C@@H](S(=O)(=O)c2ccccc2)[C@@H]2CC[C@](C)(OCc3ccccc3)[C@H]1O2 |
| InChI | InChI=1S/C22H26O4S/c1-16-20(27(23,24)18-11-7-4-8-12-18)19-13-14-22(2,21(16)26-19)25-15-17-9-5-3-6-10-17/h3-12,16,19-21H,13-15H2,1-2H3/t16-,19-,20+,21-,22-/m0/s1 |
| InChIKey | GHKNPQVFOMYHQY-SSCXBUAASA-N |
| XLogP | 4.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |