C20H21F3O4S — CID 118456541
2-[methoxy(phenyl)methyl]-4-[3-(trifluoromethyl)phenyl]sulfonyloxane (PubChem CID 118456541) has the molecular formula C20H21F3O4S and a molecular weight of 414.45 g/mol. Its IUPAC name is 2-[methoxy(phenyl)methyl]-4-[3-(trifluoromethyl)phenyl]sulfonyloxane.
| Compound Name | 2-[methoxy(phenyl)methyl]-4-[3-(trifluoromethyl)phenyl]sulfonyloxane |
|---|---|
| PubChem CID | 118456541 |
| Molecular Formula | C20H21F3O4S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-[methoxy(phenyl)methyl]-4-[3-(trifluoromethyl)phenyl]sulfonyloxane |
| SMILES | COC(c1ccccc1)C1CC(S(=O)(=O)c2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C20H21F3O4S/c1-26-19(14-6-3-2-4-7-14)18-13-17(10-11-27-18)28(24,25)16-9-5-8-15(12-16)20(21,22)23/h2-9,12,17-19H,10-11,13H2,1H3 |
| InChIKey | MHQLSILHMLBFQZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |