C19H22ClN3O2S — CID 10385820
2-(3-chlorophenyl)sulfonyl-5-piperazin-1-yl-3,4-dihydro-1H-isoquinoline (PubChem CID 10385820) has the molecular formula C19H22ClN3O2S and a molecular weight of 391.92 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfonyl-5-piperazin-1-yl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(3-chlorophenyl)sulfonyl-5-piperazin-1-yl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 10385820 |
| Molecular Formula | C19H22ClN3O2S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-(3-chlorophenyl)sulfonyl-5-piperazin-1-yl-3,4-dihydro-1H-isoquinoline |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CCc2c(cccc2N2CCNCC2)C1 |
| InChI | InChI=1S/C19H22ClN3O2S/c20-16-4-2-5-17(13-16)26(24,25)23-10-7-18-15(14-23)3-1-6-19(18)22-11-8-21-9-12-22/h1-6,13,21H,7-12,14H2 |
| InChIKey | ZTXRLSLUPFSEGU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |