C18H19ClFN3O2S — CID 142592122
2-(3-chloro-2-fluorophenyl)sulfonyl-4-piperazin-1-yl-1,3-dihydroisoindole (PubChem CID 142592122) has the molecular formula C18H19ClFN3O2S and a molecular weight of 395.89 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)sulfonyl-4-piperazin-1-yl-1,3-dihydroisoindole.
| Compound Name | 2-(3-chloro-2-fluorophenyl)sulfonyl-4-piperazin-1-yl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 142592122 |
| Molecular Formula | C18H19ClFN3O2S |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)sulfonyl-4-piperazin-1-yl-1,3-dihydroisoindole |
| SMILES | O=S(=O)(c1cccc(Cl)c1F)N1Cc2cccc(N3CCNCC3)c2C1 |
| InChI | InChI=1S/C18H19ClFN3O2S/c19-15-4-2-6-17(18(15)20)26(24,25)23-11-13-3-1-5-16(14(13)12-23)22-9-7-21-8-10-22/h1-6,21H,7-12H2 |
| InChIKey | CQLDFXCYOOIHBR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |