C13H16ClFN2O2S — CID 172895154
1-(3-chloro-2-fluorophenyl)sulfonyl-1,7-diazaspiro[3.5]nonane (PubChem CID 172895154) has the molecular formula C13H16ClFN2O2S and a molecular weight of 318.80 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)sulfonyl-1,7-diazaspiro[3.5]nonane.
| Compound Name | 1-(3-chloro-2-fluorophenyl)sulfonyl-1,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 172895154 |
| Molecular Formula | C13H16ClFN2O2S |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)sulfonyl-1,7-diazaspiro[3.5]nonane |
| SMILES | O=S(=O)(c1cccc(Cl)c1F)N1CCC12CCNCC2 |
| InChI | InChI=1S/C13H16ClFN2O2S/c14-10-2-1-3-11(12(10)15)20(18,19)17-9-6-13(17)4-7-16-8-5-13/h1-3,16H,4-9H2 |
| InChIKey | DNQLZYDZGQFKMI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |