C15H17ClFN3O4S — CID 95789139
(5S)-5-[1-(3-chloro-2-fluorophenyl)sulfonylpiperidin-4-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 95789139) has the molecular formula C15H17ClFN3O4S and a molecular weight of 389.84 g/mol. Its IUPAC name is (5S)-5-[1-(3-chloro-2-fluorophenyl)sulfonylpiperidin-4-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-(3-chloro-2-fluorophenyl)sulfonylpiperidin-4-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95789139 |
| Molecular Formula | C15H17ClFN3O4S |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | (5S)-5-[1-(3-chloro-2-fluorophenyl)sulfonylpiperidin-4-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(C2CCN(S(=O)(=O)c3cccc(Cl)c3F)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C15H17ClFN3O4S/c1-15(13(21)18-14(22)19-15)9-5-7-20(8-6-9)25(23,24)11-4-2-3-10(16)12(11)17/h2-4,9H,5-8H2,1H3,(H2,18,19,21,22)/t15-/m0/s1 |
| InChIKey | IIPBHZWLVDFGPQ-HNNXBMFYSA-N |
| XLogP | 1.48 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|