C21H29N3O4S — CID 139009104
5-[1-(4-cyclohexylphenyl)sulfonylpiperidin-4-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 139009104) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is 5-[1-(4-cyclohexylphenyl)sulfonylpiperidin-4-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[1-(4-cyclohexylphenyl)sulfonylpiperidin-4-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139009104 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 5-[1-(4-cyclohexylphenyl)sulfonylpiperidin-4-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(C2CCN(S(=O)(=O)c3ccc(C4CCCCC4)cc3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H29N3O4S/c1-21(19(25)22-20(26)23-21)17-11-13-24(14-12-17)29(27,28)18-9-7-16(8-10-18)15-5-3-2-4-6-15/h7-10,15,17H,2-6,11-14H2,1H3,(H2,22,23,25,26) |
| InChIKey | PIYSFKQORCMVAC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|