C18H20FN3O2S — CID 142592131
2-(2-fluorophenyl)sulfonyl-4-piperazin-1-yl-1,3-dihydroisoindole (PubChem CID 142592131) has the molecular formula C18H20FN3O2S and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfonyl-4-piperazin-1-yl-1,3-dihydroisoindole.
| Compound Name | 2-(2-fluorophenyl)sulfonyl-4-piperazin-1-yl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 142592131 |
| Molecular Formula | C18H20FN3O2S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-(2-fluorophenyl)sulfonyl-4-piperazin-1-yl-1,3-dihydroisoindole |
| SMILES | O=S(=O)(c1ccccc1F)N1Cc2cccc(N3CCNCC3)c2C1 |
| InChI | InChI=1S/C18H20FN3O2S/c19-16-5-1-2-7-18(16)25(23,24)22-12-14-4-3-6-17(15(14)13-22)21-10-8-20-9-11-21/h1-7,20H,8-13H2 |
| InChIKey | UZFYJPAXAUCAPB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |