C19H33N5O2S — CID 10386028
tert-butyl N-[2-[[5-(3,3-dimethylbutan-2-ylcarbamothioylamino)-2-pyridinyl]amino]ethyl]carbamate (PubChem CID 10386028) has the molecular formula C19H33N5O2S and a molecular weight of 395.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(3,3-dimethylbutan-2-ylcarbamothioylamino)-2-pyridinyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-(3,3-dimethylbutan-2-ylcarbamothioylamino)-2-pyridinyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 10386028 |
| Molecular Formula | C19H33N5O2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | tert-butyl N-[2-[[5-(3,3-dimethylbutan-2-ylcarbamothioylamino)-2-pyridinyl]amino]ethyl]carbamate |
| SMILES | CC(NC(=S)Nc1ccc(NCCNC(=O)OC(C)(C)C)nc1)C(C)(C)C |
| InChI | InChI=1S/C19H33N5O2S/c1-13(18(2,3)4)23-16(27)24-14-8-9-15(22-12-14)20-10-11-21-17(25)26-19(5,6)7/h8-9,12-13H,10-11H2,1-7H3,(H,20,22)(H,21,25)(H2,23,24,27) |
| InChIKey | MDLSQQQKXYPWDK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|