C22H24N2O5 — CID 10386049
(1R,2R)-2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-1-yl]-6-nitro-2,3-dihydro-1H-inden-1-ol (PubChem CID 10386049) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is (1R,2R)-2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-1-yl]-6-nitro-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R,2R)-2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-1-yl]-6-nitro-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 10386049 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (1R,2R)-2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperidin-1-yl]-6-nitro-2,3-dihydro-1H-inden-1-ol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[C@@H](O)[C@H](N1CCC(c3cccc4c3OCCO4)CC1)C2 |
| InChI | InChI=1S/C22H24N2O5/c25-21-18-13-16(24(26)27)5-4-15(18)12-19(21)23-8-6-14(7-9-23)17-2-1-3-20-22(17)29-11-10-28-20/h1-5,13-14,19,21,25H,6-12H2/t19-,21-/m1/s1 |
| InChIKey | RWTANMAVZULOKT-TZIWHRDSSA-N |
| XLogP | 3.20 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|