C26H21N3O5 — CID 10389289
(13S)-8-oxo-11-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2(7),3,5,9-tetraene-4-carbonitrile (PubChem CID 10389289) has the molecular formula C26H21N3O5 and a molecular weight of 455.47 g/mol. Its IUPAC name is (13S)-8-oxo-11-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2(7),3,5,9-tetraene-4-carbonitrile.
| Compound Name | (13S)-8-oxo-11-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2(7),3,5,9-tetraene-4-carbonitrile |
|---|---|
| PubChem CID | 10389289 |
| Molecular Formula | C26H21N3O5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (13S)-8-oxo-11-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2(7),3,5,9-tetraene-4-carbonitrile |
| SMILES | COc1cc2cc(C(=O)N3C[C@H]4CC45C3=CC(=O)c3ccc(C#N)cc35)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C26H21N3O5/c1-32-20-8-14-7-18(28-22(14)24(34-3)23(20)33-2)25(31)29-12-15-10-26(15)17-6-13(11-27)4-5-16(17)19(30)9-21(26)29/h4-9,15,28H,10,12H2,1-3H3/t15-,26?/m1/s1 |
| InChIKey | CYFRMSZZXCTBTR-GJNAARLKSA-N |
| XLogP | 3.56 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |