C22H15N3O4 — CID 11211318
(13S)-11-(6-nitro-1H-indole-2-carbonyl)-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraen-8-one (PubChem CID 11211318) has the molecular formula C22H15N3O4 and a molecular weight of 385.38 g/mol. Its IUPAC name is (13S)-11-(6-nitro-1H-indole-2-carbonyl)-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraen-8-one.
| Compound Name | (13S)-11-(6-nitro-1H-indole-2-carbonyl)-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraen-8-one |
|---|---|
| PubChem CID | 11211318 |
| Molecular Formula | C22H15N3O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (13S)-11-(6-nitro-1H-indole-2-carbonyl)-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraen-8-one |
| SMILES | O=C1C=C2N(C(=O)c3cc4ccc([N+](=O)[O-])cc4[nH]3)C[C@H]3CC23c2ccccc21 |
| InChI | InChI=1S/C22H15N3O4/c26-19-9-20-22(16-4-2-1-3-15(16)19)10-13(22)11-24(20)21(27)18-7-12-5-6-14(25(28)29)8-17(12)23-18/h1-9,13,23H,10-11H2/t13-,22?/m1/s1 |
| InChIKey | KWZXDTBUUKJLJL-BXWDTWGJSA-N |
| XLogP | 3.57 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|