C23H18N4O3 — CID 142969457
[(1R,13S)-8-methylidene-11,14-diazatetracyclo[8.5.0.01,13.02,7]pentadeca-2,4,6,9-tetraen-11-yl]-(6-nitro-1H-indol-2-yl)methanone (PubChem CID 142969457) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is [(1R,13S)-8-methylidene-11,14-diazatetracyclo[8.5.0.01,13.02,7]pentadeca-2,4,6,9-tetraen-11-yl]-(6-nitro-1H-indol-2-yl)methanone.
| Compound Name | [(1R,13S)-8-methylidene-11,14-diazatetracyclo[8.5.0.01,13.02,7]pentadeca-2,4,6,9-tetraen-11-yl]-(6-nitro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 142969457 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [(1R,13S)-8-methylidene-11,14-diazatetracyclo[8.5.0.01,13.02,7]pentadeca-2,4,6,9-tetraen-11-yl]-(6-nitro-1H-indol-2-yl)methanone |
| SMILES | C=C1C=C2N(C(=O)c3cc4ccc([N+](=O)[O-])cc4[nH]3)C[C@H]3NC[C@@]23c2ccccc21 |
| InChI | InChI=1S/C23H18N4O3/c1-13-8-21-23(17-5-3-2-4-16(13)17)12-24-20(23)11-26(21)22(28)19-9-14-6-7-15(27(29)30)10-18(14)25-19/h2-10,20,24-25H,1,11-12H2/t20-,23+/m1/s1 |
| InChIKey | BPJRAPYTNUTMOP-OFNKIYASSA-N |
| XLogP | 3.35 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|