About 6-nitro-1H-indol-2-ol
6-nitro-1H-indol-2-ol (PubChem CID 131587849) has the molecular formula C8H6N2O3
and a molecular weight of 178.15 g/mol. Its IUPAC name is 6-nitro-1H-indol-2-ol.
Molecular Properties
| Compound Name | 6-nitro-1H-indol-2-ol |
| PubChem CID | 131587849 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 6-nitro-1H-indol-2-ol |
| SMILES | O=[N+]([O-])c1ccc2cc(O)[nH]c2c1 |
| InChI | InChI=1S/C8H6N2O3/c11-8-3-5-1-2-6(10(12)13)4-7(5)9-8/h1-4,9,11H |
| InChIKey | VAWICFRIKXWUDM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-1H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-1H-indol-2-ol?
The IUPAC name of 6-nitro-1H-indol-2-ol (CID 131587849) is 6-nitro-1H-indol-2-ol.
What is the SMILES notation for 6-nitro-1H-indol-2-ol?
The canonical SMILES for 6-nitro-1H-indol-2-ol is O=[N+]([O-])c1ccc2cc(O)[nH]c2c1.
What is the InChIKey of 6-nitro-1H-indol-2-ol?
The InChIKey is VAWICFRIKXWUDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3/c11-8-3-5-1-2-6(10(12)13)4-7(5)9-8/h1-4,9,11H.
What are the key properties of 6-nitro-1H-indol-2-ol?
6-nitro-1H-indol-2-ol has a molecular weight of 178.15 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-1H-indol-2-ol is sourced from PubChem (CID 131587849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).