C14H18BrNO — CID 103901793
N-(4-bromo-2,3-dihydro-1H-inden-1-yl)oxan-4-amine (PubChem CID 103901793) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is N-(4-bromo-2,3-dihydro-1H-inden-1-yl)oxan-4-amine.
| Compound Name | N-(4-bromo-2,3-dihydro-1H-inden-1-yl)oxan-4-amine |
|---|---|
| PubChem CID | 103901793 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(4-bromo-2,3-dihydro-1H-inden-1-yl)oxan-4-amine |
| SMILES | Brc1cccc2c1CCC2NC1CCOCC1 |
| InChI | InChI=1S/C14H18BrNO/c15-13-3-1-2-12-11(13)4-5-14(12)16-10-6-8-17-9-7-10/h1-3,10,14,16H,4-9H2 |
| InChIKey | AGZIDGJQJJHDDO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |