C23H29N3O6S — CID 10390189
N-hydroxy-4-[4-(5-phenylmethoxy-2-pyridinyl)piperidin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 10390189) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-hydroxy-4-[4-(5-phenylmethoxy-2-pyridinyl)piperidin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-(5-phenylmethoxy-2-pyridinyl)piperidin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10390189 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N-hydroxy-4-[4-(5-phenylmethoxy-2-pyridinyl)piperidin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(c3ccc(OCc4ccccc4)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C23H29N3O6S/c27-22(25-28)23(10-14-31-15-11-23)33(29,30)26-12-8-19(9-13-26)21-7-6-20(16-24-21)32-17-18-4-2-1-3-5-18/h1-7,16,19,28H,8-15,17H2,(H,25,27) |
| InChIKey | DGCYVDNAHQKIFG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|