C19H27F2N3O6S — CID 11754138
4-[4-[5-(2,2-difluoropropoxy)-2-pyridinyl]piperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 11754138) has the molecular formula C19H27F2N3O6S and a molecular weight of 463.50 g/mol. Its IUPAC name is 4-[4-[5-(2,2-difluoropropoxy)-2-pyridinyl]piperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[5-(2,2-difluoropropoxy)-2-pyridinyl]piperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 11754138 |
| Molecular Formula | C19H27F2N3O6S |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-[4-[5-(2,2-difluoropropoxy)-2-pyridinyl]piperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | CC(F)(F)COc1ccc(C2CCN(S(=O)(=O)C3(C(=O)NO)CCOCC3)CC2)nc1 |
| InChI | InChI=1S/C19H27F2N3O6S/c1-18(20,21)13-30-15-2-3-16(22-12-15)14-4-8-24(9-5-14)31(27,28)19(17(25)23-26)6-10-29-11-7-19/h2-3,12,14,26H,4-11,13H2,1H3,(H,23,25) |
| InChIKey | AJDJVUXNXVXAIH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|