C23H22F2N2O7 — CID 10390225
methyl 3-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-3-(4-nitro-3-oxo-1H-isoindol-2-yl)propanoate (PubChem CID 10390225) has the molecular formula C23H22F2N2O7 and a molecular weight of 476.43 g/mol. Its IUPAC name is methyl 3-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-3-(4-nitro-3-oxo-1H-isoindol-2-yl)propanoate.
| Compound Name | methyl 3-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-3-(4-nitro-3-oxo-1H-isoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 10390225 |
| Molecular Formula | C23H22F2N2O7 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | methyl 3-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-3-(4-nitro-3-oxo-1H-isoindol-2-yl)propanoate |
| SMILES | COC(=O)CC(c1ccc(OC(F)F)c(OCC2CC2)c1)N1Cc2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C23H22F2N2O7/c1-32-20(28)10-17(26-11-15-3-2-4-16(27(30)31)21(15)22(26)29)14-7-8-18(34-23(24)25)19(9-14)33-12-13-5-6-13/h2-4,7-9,13,17,23H,5-6,10-12H2,1H3 |
| InChIKey | NQEDSOZFQXUPKW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|