C15H19BrFNO — CID 103905794
N-[1-(2-bromo-4-fluorophenyl)ethyl]-2-cyclopropyloxolan-3-amine (PubChem CID 103905794) has the molecular formula C15H19BrFNO and a molecular weight of 328.23 g/mol. Its IUPAC name is N-[1-(2-bromo-4-fluorophenyl)ethyl]-2-cyclopropyloxolan-3-amine.
| Compound Name | N-[1-(2-bromo-4-fluorophenyl)ethyl]-2-cyclopropyloxolan-3-amine |
|---|---|
| PubChem CID | 103905794 |
| Molecular Formula | C15H19BrFNO |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[1-(2-bromo-4-fluorophenyl)ethyl]-2-cyclopropyloxolan-3-amine |
| SMILES | CC(NC1CCOC1C1CC1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C15H19BrFNO/c1-9(12-5-4-11(17)8-13(12)16)18-14-6-7-19-15(14)10-2-3-10/h4-5,8-10,14-15,18H,2-3,6-7H2,1H3 |
| InChIKey | CQMPXJOWZFMQFR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |