C21H20F5N5O3 — CID 10390642
(1Z)-N-[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-dimethylazaniumyl]-4-(trifluoromethoxy)benzenecarboximidate (PubChem CID 10390642) has the molecular formula C21H20F5N5O3 and a molecular weight of 485.41 g/mol. Its IUPAC name is (1Z)-N-[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-dimethylazaniumyl]-4-(trifluoromethoxy)benzenecarboximidate.
| Compound Name | (1Z)-N-[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-dimethylazaniumyl]-4-(trifluoromethoxy)benzenecarboximidate |
|---|---|
| PubChem CID | 10390642 |
| Molecular Formula | C21H20F5N5O3 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | (1Z)-N-[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-dimethylazaniumyl]-4-(trifluoromethoxy)benzenecarboximidate |
| SMILES | C[N+](C)(CC(O)(Cn1cncn1)c1ccc(F)cc1F)/N=C(\[O-])c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F5N5O3/c1-31(2,29-19(32)14-3-6-16(7-4-14)34-21(24,25)26)11-20(33,10-30-13-27-12-28-30)17-8-5-15(22)9-18(17)23/h3-9,12-13,33H,10-11H2,1-2H3 |
| InChIKey | IJSJEWDWXBKMMB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|