C10H20N2O3 — CID 103914239
2-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide (PubChem CID 103914239) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide.
| Compound Name | 2-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 103914239 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide |
| SMILES | CC(C)C(NCC1CCOCO1)C(N)=O |
| InChI | InChI=1S/C10H20N2O3/c1-7(2)9(10(11)13)12-5-8-3-4-14-6-15-8/h7-9,12H,3-6H2,1-2H3,(H2,11,13) |
| InChIKey | MBNNEISWHHBTNO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |