C14H27NO2 — CID 81102685
1-cyclohexyl-N-(1,3-dioxan-4-ylmethyl)propan-1-amine (PubChem CID 81102685) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 1-cyclohexyl-N-(1,3-dioxan-4-ylmethyl)propan-1-amine.
| Compound Name | 1-cyclohexyl-N-(1,3-dioxan-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 81102685 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 1-cyclohexyl-N-(1,3-dioxan-4-ylmethyl)propan-1-amine |
| SMILES | CCC(NCC1CCOCO1)C1CCCCC1 |
| InChI | InChI=1S/C14H27NO2/c1-2-14(12-6-4-3-5-7-12)15-10-13-8-9-16-11-17-13/h12-15H,2-11H2,1H3 |
| InChIKey | SNLVCCPRNNYABK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |