C37H33N3O2 — CID 10392836
(7S)-7-[(R)-hydroxy-(5-methyl-1-tritylimidazol-4-yl)methyl]-10-methyl-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one (PubChem CID 10392836) has the molecular formula C37H33N3O2 and a molecular weight of 551.69 g/mol. Its IUPAC name is (7S)-7-[(R)-hydroxy-(5-methyl-1-tritylimidazol-4-yl)methyl]-10-methyl-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one.
| Compound Name | (7S)-7-[(R)-hydroxy-(5-methyl-1-tritylimidazol-4-yl)methyl]-10-methyl-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one |
|---|---|
| PubChem CID | 10392836 |
| Molecular Formula | C37H33N3O2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | (7S)-7-[(R)-hydroxy-(5-methyl-1-tritylimidazol-4-yl)methyl]-10-methyl-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one |
| SMILES | Cc1c2n(c3ccccc13)C(=O)[C@H]([C@@H](O)c1ncn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c1C)CC2 |
| InChI | InChI=1S/C37H33N3O2/c1-25-30-20-12-13-21-33(30)40-32(25)23-22-31(36(40)42)35(41)34-26(2)39(24-38-34)37(27-14-6-3-7-15-27,28-16-8-4-9-17-28)29-18-10-5-11-19-29/h3-21,24,31,35,41H,22-23H2,1-2H3/t31-,35+/m0/s1 |
| InChIKey | JVLYKLFWNYVKFK-MFACQUFMSA-N |
| XLogP | 7.23 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|