C34H27N3O2 — CID 139091525
(5aR,8aR)-7-phenyl-3-trityl-4,5,5a,8a-tetrahydropyrrolo[3,4-e]benzimidazole-6,8-dione (PubChem CID 139091525) has the molecular formula C34H27N3O2 and a molecular weight of 509.61 g/mol. Its IUPAC name is (5aR,8aR)-7-phenyl-3-trityl-4,5,5a,8a-tetrahydropyrrolo[3,4-e]benzimidazole-6,8-dione.
| Compound Name | (5aR,8aR)-7-phenyl-3-trityl-4,5,5a,8a-tetrahydropyrrolo[3,4-e]benzimidazole-6,8-dione |
|---|---|
| PubChem CID | 139091525 |
| Molecular Formula | C34H27N3O2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | (5aR,8aR)-7-phenyl-3-trityl-4,5,5a,8a-tetrahydropyrrolo[3,4-e]benzimidazole-6,8-dione |
| SMILES | O=C1[C@@H]2CCc3c(ncn3C(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C34H27N3O2/c38-32-28-21-22-29-31(30(28)33(39)37(32)27-19-11-4-12-20-27)35-23-36(29)34(24-13-5-1-6-14-24,25-15-7-2-8-16-25)26-17-9-3-10-18-26/h1-20,23,28,30H,21-22H2/t28-,30-/m1/s1 |
| InChIKey | VLCIJQGBLXUVTB-PQHLKRTFSA-N |
| XLogP | 5.94 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|