C31H56O6Si — CID 10392869
ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,6R)-6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate (PubChem CID 10392869) has the molecular formula C31H56O6Si and a molecular weight of 552.87 g/mol. Its IUPAC name is ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,6R)-6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate.
| Compound Name | ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,6R)-6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate |
|---|---|
| PubChem CID | 10392869 |
| Molecular Formula | C31H56O6Si |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,6R)-6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate |
| SMILES | CCOC(=O)[C@@](C)(C/C=C(C)/C=C/CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)[C@H]1C[C@@H](CCO)OC(C)(C)O1 |
| InChI | InChI=1S/C31H56O6Si/c1-12-34-28(33)31(9,27-22-26(19-21-32)36-30(7,8)37-27)20-18-24(2)16-14-13-15-17-25(3)23-35-38(10,11)29(4,5)6/h14,16-18,26-27,32H,12-13,15,19-23H2,1-11H3/b16-14+,24-18+,25-17+/t26-,27-,31+/m1/s1 |
| InChIKey | SPKRXLNSRYWBSJ-QGVSBIBZSA-N |
| XLogP | 7.49 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|