C10H11Br2NO3S — CID 103932811
4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid (PubChem CID 103932811) has the molecular formula C10H11Br2NO3S and a molecular weight of 385.08 g/mol. Its IUPAC name is 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid.
| Compound Name | 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 103932811 |
| Molecular Formula | C10H11Br2NO3S |
| Molecular Weight | 385.08 g/mol |
| Exact Mass | 382.88 |
| IUPAC Name | 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H11Br2NO3S/c1-5(2-3-8(14)15)13-10(16)6-4-7(11)17-9(6)12/h4-5H,2-3H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | MUAUGNOFJYLHQP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.08 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |