4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid

C10H11Br2NO3S — CID 103932811

IUPAC4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid
SMILESCC(CCC(=O)O)NC(=O)c1cc(Br)sc1Br
InChIInChI=1S/C10H11Br2NO3S/c1-5(2-3-8(14)15)13-10(16)6-4-7(11)17-9(6)12/h4-5H,2-3H2,1H3,(H,13,16)(H,14,15)
InChIKeyMUAUGNOFJYLHQP-UHFFFAOYSA-N
MW385.08 g/mol
LogP3.26
Rot. Bonds5

About 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid

4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid (PubChem CID 103932811) has the molecular formula C10H11Br2NO3S and a molecular weight of 385.08 g/mol. Its IUPAC name is 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid.

Molecular Properties

Compound Name4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid
PubChem CID103932811
Molecular FormulaC10H11Br2NO3S
Molecular Weight385.08 g/mol
Exact Mass382.88
IUPAC Name4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid
SMILESCC(CCC(=O)O)NC(=O)c1cc(Br)sc1Br
InChIInChI=1S/C10H11Br2NO3S/c1-5(2-3-8(14)15)13-10(16)6-4-7(11)17-9(6)12/h4-5H,2-3H2,1H3,(H,13,16)(H,14,15)
InChIKeyMUAUGNOFJYLHQP-UHFFFAOYSA-N
XLogP3.26
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500385.08
LogP ≤ 53.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid?
The IUPAC name of 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid (CID 103932811) is 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid.
What is the SMILES notation for 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid?
The canonical SMILES for 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid is CC(CCC(=O)O)NC(=O)c1cc(Br)sc1Br.
What is the InChIKey of 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid?
The InChIKey is MUAUGNOFJYLHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Br2NO3S/c1-5(2-3-8(14)15)13-10(16)6-4-7(11)17-9(6)12/h4-5H,2-3H2,1H3,(H,13,16)(H,14,15).
What are the key properties of 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid?
4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid has a molecular weight of 385.08 g/mol, XLogP of 3.26, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dibromothiophene-3-carbonyl)amino]pentanoic acid is sourced from PubChem (CID 103932811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).