C9H20N2O2 — CID 103933635
3-(3-hydroxy-2,3-dimethylbutan-2-yl)-1,1-dimethylurea (PubChem CID 103933635) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-(3-hydroxy-2,3-dimethylbutan-2-yl)-1,1-dimethylurea.
| Compound Name | 3-(3-hydroxy-2,3-dimethylbutan-2-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 103933635 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 3-(3-hydroxy-2,3-dimethylbutan-2-yl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C9H20N2O2/c1-8(2,9(3,4)13)10-7(12)11(5)6/h13H,1-6H3,(H,10,12) |
| InChIKey | OYVCAYCRSGCRMF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |