C19H24N4O2 — CID 146447985
3-[(dimethylcarbamoylamino)-diphenylmethyl]-1,1-dimethylurea (PubChem CID 146447985) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-[(dimethylcarbamoylamino)-diphenylmethyl]-1,1-dimethylurea.
| Compound Name | 3-[(dimethylcarbamoylamino)-diphenylmethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 146447985 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 3-[(dimethylcarbamoylamino)-diphenylmethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC(NC(=O)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24N4O2/c1-22(2)17(24)20-19(21-18(25)23(3)4,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,1-4H3,(H,20,24)(H,21,25) |
| InChIKey | MFJSYYKZSSNPJH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|