C22H22N2O2 — CID 10497782
3-[2-[hydroxy(diphenyl)methyl]phenyl]-1,1-dimethylurea (PubChem CID 10497782) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[2-[hydroxy(diphenyl)methyl]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[hydroxy(diphenyl)methyl]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 10497782 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 3-[2-[hydroxy(diphenyl)methyl]phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccccc1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c1-24(2)21(25)23-20-16-10-9-15-19(20)22(26,17-11-5-3-6-12-17)18-13-7-4-8-14-18/h3-16,26H,1-2H3,(H,23,25) |
| InChIKey | BGPBDHYCJXTVIQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|