C35H38F3NO5 — CID 10393941
[(E,2S,3S)-5-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,7-diphenylhept-6-en-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10393941) has the molecular formula C35H38F3NO5 and a molecular weight of 609.69 g/mol. Its IUPAC name is [(E,2S,3S)-5-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,7-diphenylhept-6-en-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(E,2S,3S)-5-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,7-diphenylhept-6-en-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10393941 |
| Molecular Formula | C35H38F3NO5 |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | [(E,2S,3S)-5-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,7-diphenylhept-6-en-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C(/C=C/c1ccccc1)C[C@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H38F3NO5/c1-25(21-22-26-15-9-6-10-16-26)23-30(29(24-27-17-11-7-12-18-27)39-32(41)44-33(2,3)4)43-31(40)34(42-5,35(36,37)38)28-19-13-8-14-20-28/h6-22,29-30H,1,23-24H2,2-5H3,(H,39,41)/b22-21+/t29-,30-,34+/m0/s1 |
| InChIKey | VGNPMXCVLOZTNZ-LMLIGEPRSA-N |
| XLogP | 7.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|