C35H48O6SSi — CID 10394176
[9-[tert-butyl(diphenyl)silyl]oxy-4-(1,3-dioxolan-2-yl)nonyl] 4-methylbenzenesulfonate (PubChem CID 10394176) has the molecular formula C35H48O6SSi and a molecular weight of 624.92 g/mol. Its IUPAC name is [9-[tert-butyl(diphenyl)silyl]oxy-4-(1,3-dioxolan-2-yl)nonyl] 4-methylbenzenesulfonate.
| Compound Name | [9-[tert-butyl(diphenyl)silyl]oxy-4-(1,3-dioxolan-2-yl)nonyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10394176 |
| Molecular Formula | C35H48O6SSi |
| Molecular Weight | 624.92 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | [9-[tert-butyl(diphenyl)silyl]oxy-4-(1,3-dioxolan-2-yl)nonyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCC(CCCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C2OCCO2)cc1 |
| InChI | InChI=1S/C35H48O6SSi/c1-29-21-23-31(24-22-29)42(36,37)40-25-14-16-30(34-38-27-28-39-34)15-8-7-13-26-41-43(35(2,3)4,32-17-9-5-10-18-32)33-19-11-6-12-20-33/h5-6,9-12,17-24,30,34H,7-8,13-16,25-28H2,1-4H3 |
| InChIKey | MMFFNQZAMUNOQB-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.92 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|