C8H9F4N3O — CID 103944434
N-(4-ethyl-1H-pyrazol-5-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103944434) has the molecular formula C8H9F4N3O and a molecular weight of 239.17 g/mol. Its IUPAC name is N-(4-ethyl-1H-pyrazol-5-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(4-ethyl-1H-pyrazol-5-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103944434 |
| Molecular Formula | C8H9F4N3O |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | N-(4-ethyl-1H-pyrazol-5-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCc1cn[nH]c1NC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H9F4N3O/c1-2-4-3-13-15-5(4)14-7(16)8(11,12)6(9)10/h3,6H,2H2,1H3,(H2,13,14,15,16) |
| InChIKey | BBKINGANSIYGAT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|