C19H26N2 — CID 103961166
3,3,5,5-tetramethyl-1-quinolin-8-ylcyclohexan-1-amine (PubChem CID 103961166) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-quinolin-8-ylcyclohexan-1-amine.
| Compound Name | 3,3,5,5-tetramethyl-1-quinolin-8-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 103961166 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-quinolin-8-ylcyclohexan-1-amine |
| SMILES | CC1(C)CC(C)(C)CC(N)(c2cccc3cccnc23)C1 |
| InChI | InChI=1S/C19H26N2/c1-17(2)11-18(3,4)13-19(20,12-17)15-9-5-7-14-8-6-10-21-16(14)15/h5-10H,11-13,20H2,1-4H3 |
| InChIKey | WUEKQBXRLSCXDT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |